C19H32NO4+ — CID 90672709
tert-butyl-[3-[[(6R,7S)-6,7-dihydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]-2-hydroxypropyl]-dimethylazanium (PubChem CID 90672709) has the molecular formula C19H32NO4+ and a molecular weight of 338.47 g/mol. Its IUPAC name is tert-butyl-[3-[[(6R,7S)-6,7-dihydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]-2-hydroxypropyl]-dimethylazanium.
| Compound Name | tert-butyl-[3-[[(6R,7S)-6,7-dihydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]-2-hydroxypropyl]-dimethylazanium |
|---|---|
| PubChem CID | 90672709 |
| Molecular Formula | C19H32NO4+ |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | tert-butyl-[3-[[(6R,7S)-6,7-dihydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]-2-hydroxypropyl]-dimethylazanium |
| SMILES | CC(C)(C)[N+](C)(C)CC(O)COc1cccc2c1C[C@H](O)[C@H](O)C2 |
| InChI | InChI=1S/C19H32NO4/c1-19(2,3)20(4,5)11-14(21)12-24-18-8-6-7-13-9-16(22)17(23)10-15(13)18/h6-8,14,16-17,21-23H,9-12H2,1-5H3/q+1/t14?,16-,17+/m1/s1 |
| InChIKey | VFFDEMMOAGDEAX-XMKPYSNPSA-N |
| XLogP | 1.12 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|