C16H22O5 — CID 12849938
5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-1,2,3,4-tetrahydronaphthalene-2,3-diol (PubChem CID 12849938) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is 5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-1,2,3,4-tetrahydronaphthalene-2,3-diol.
| Compound Name | 5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-1,2,3,4-tetrahydronaphthalene-2,3-diol |
|---|---|
| PubChem CID | 12849938 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-1,2,3,4-tetrahydronaphthalene-2,3-diol |
| SMILES | CC1(C)OCC(COc2cccc3c2CC(O)C(O)C3)O1 |
| InChI | InChI=1S/C16H22O5/c1-16(2)20-9-11(21-16)8-19-15-5-3-4-10-6-13(17)14(18)7-12(10)15/h3-5,11,13-14,17-18H,6-9H2,1-2H3 |
| InChIKey | COLCVULWHXEIIS-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |