C21H21ClO4 — CID 67361716
6-chloro-12-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one (PubChem CID 67361716) has the molecular formula C21H21ClO4 and a molecular weight of 372.85 g/mol. Its IUPAC name is 6-chloro-12-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one.
| Compound Name | 6-chloro-12-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one |
|---|---|
| PubChem CID | 67361716 |
| Molecular Formula | C21H21ClO4 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 6-chloro-12-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one |
| SMILES | CC1(C)OC[C@H](COc2cccc3c2CCc2cc(Cl)ccc2C3=O)O1 |
| InChI | InChI=1S/C21H21ClO4/c1-21(2)25-12-15(26-21)11-24-19-5-3-4-18-17(19)8-6-13-10-14(22)7-9-16(13)20(18)23/h3-5,7,9-10,15H,6,8,11-12H2,1-2H3/t15-/m0/s1 |
| InChIKey | MDFUBIZFVLKZQT-HNNXBMFYSA-N |
| XLogP | 4.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |