C14H19O5P — CID 101131968
3-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-1,5-dihydro-2,4,3-benzodioxaphosphepine (PubChem CID 101131968) has the molecular formula C14H19O5P and a molecular weight of 298.27 g/mol. Its IUPAC name is 3-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-1,5-dihydro-2,4,3-benzodioxaphosphepine.
| Compound Name | 3-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-1,5-dihydro-2,4,3-benzodioxaphosphepine |
|---|---|
| PubChem CID | 101131968 |
| Molecular Formula | C14H19O5P |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 3-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-1,5-dihydro-2,4,3-benzodioxaphosphepine |
| SMILES | CC1(C)OC[C@H](COP2OCc3ccccc3CO2)O1 |
| InChI | InChI=1S/C14H19O5P/c1-14(2)15-9-13(19-14)10-18-20-16-7-11-5-3-4-6-12(11)8-17-20/h3-6,13H,7-10H2,1-2H3/t13-/m1/s1 |
| InChIKey | UYBVPKBXEOKKFP-CYBMUJFWSA-N |
| XLogP | 3.13 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|