About (4R)-2,2-dimethyl-4-[2-(4-phenylphenyl)propan-2-yloxymethyl]-1,3-dioxolane
(4R)-2,2-dimethyl-4-[2-(4-phenylphenyl)propan-2-yloxymethyl]-1,3-dioxolane (PubChem CID 164671822) has the molecular formula C21H26O3
and a molecular weight of 326.44 g/mol. Its IUPAC name is (4R)-2,2-dimethyl-4-[2-(4-phenylphenyl)propan-2-yloxymethyl]-1,3-dioxolane.
Molecular Properties
| Compound Name | (4R)-2,2-dimethyl-4-[2-(4-phenylphenyl)propan-2-yloxymethyl]-1,3-dioxolane |
| PubChem CID | 164671822 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | (4R)-2,2-dimethyl-4-[2-(4-phenylphenyl)propan-2-yloxymethyl]-1,3-dioxolane |
| SMILES | CC1(C)OC[C@@H](COC(C)(C)c2ccc(-c3ccccc3)cc2)O1 |
| InChI | InChI=1S/C21H26O3/c1-20(2,22-14-19-15-23-21(3,4)24-19)18-12-10-17(11-13-18)16-8-6-5-7-9-16/h5-13,19H,14-15H2,1-4H3/t19-/m1/s1 |
| InChIKey | WMTNCKAXAZTFJO-LJQANCHMSA-N |
| XLogP | 4.76 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-2,2-dimethyl-4-[2-(4-phenylphenyl)propan-2-yloxymethyl]-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2,2-dimethyl-4-[2-(4-phenylphenyl)propan-2-yloxymethyl]-1,3-dioxolane?
The IUPAC name of (4R)-2,2-dimethyl-4-[2-(4-phenylphenyl)propan-2-yloxymethyl]-1,3-dioxolane (CID 164671822) is (4R)-2,2-dimethyl-4-[2-(4-phenylphenyl)propan-2-yloxymethyl]-1,3-dioxolane.
What is the SMILES notation for (4R)-2,2-dimethyl-4-[2-(4-phenylphenyl)propan-2-yloxymethyl]-1,3-dioxolane?
The canonical SMILES for (4R)-2,2-dimethyl-4-[2-(4-phenylphenyl)propan-2-yloxymethyl]-1,3-dioxolane is CC1(C)OC[C@@H](COC(C)(C)c2ccc(-c3ccccc3)cc2)O1.
What is the InChIKey of (4R)-2,2-dimethyl-4-[2-(4-phenylphenyl)propan-2-yloxymethyl]-1,3-dioxolane?
The InChIKey is WMTNCKAXAZTFJO-LJQANCHMSA-N. The full InChI is InChI=1S/C21H26O3/c1-20(2,22-14-19-15-23-21(3,4)24-19)18-12-10-17(11-13-18)16-8-6-5-7-9-16/h5-13,19H,14-15H2,1-4H3/t19-/m1/s1.
What are the key properties of (4R)-2,2-dimethyl-4-[2-(4-phenylphenyl)propan-2-yloxymethyl]-1,3-dioxolane?
(4R)-2,2-dimethyl-4-[2-(4-phenylphenyl)propan-2-yloxymethyl]-1,3-dioxolane has a molecular weight of 326.44 g/mol, XLogP of 4.76, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2,2-dimethyl-4-[2-(4-phenylphenyl)propan-2-yloxymethyl]-1,3-dioxolane is sourced from PubChem (CID 164671822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).