C22H36N2O9 — CID 11374864
[1-(propan-2-ylamino)-3-[4-(2-propan-2-yloxyethoxymethyl)phenoxy]propan-2-yl] 2-(2-nitrooxyethoxy)acetate (PubChem CID 11374864) has the molecular formula C22H36N2O9 and a molecular weight of 472.54 g/mol. Its IUPAC name is [1-(propan-2-ylamino)-3-[4-(2-propan-2-yloxyethoxymethyl)phenoxy]propan-2-yl] 2-(2-nitrooxyethoxy)acetate.
| Compound Name | [1-(propan-2-ylamino)-3-[4-(2-propan-2-yloxyethoxymethyl)phenoxy]propan-2-yl] 2-(2-nitrooxyethoxy)acetate |
|---|---|
| PubChem CID | 11374864 |
| Molecular Formula | C22H36N2O9 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | [1-(propan-2-ylamino)-3-[4-(2-propan-2-yloxyethoxymethyl)phenoxy]propan-2-yl] 2-(2-nitrooxyethoxy)acetate |
| SMILES | CC(C)NCC(COc1ccc(COCCOC(C)C)cc1)OC(=O)COCCO[N+](=O)[O-] |
| InChI | InChI=1S/C22H36N2O9/c1-17(2)23-13-21(33-22(25)16-29-10-12-32-24(26)27)15-31-20-7-5-19(6-8-20)14-28-9-11-30-18(3)4/h5-8,17-18,21,23H,9-16H2,1-4H3 |
| InChIKey | BTLTTWCENCLMAF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 127.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|