C18H29N3O6 — CID 70353614
3-[[2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetyl]-methylamino]propyl nitrate (PubChem CID 70353614) has the molecular formula C18H29N3O6 and a molecular weight of 383.45 g/mol. Its IUPAC name is 3-[[2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetyl]-methylamino]propyl nitrate.
| Compound Name | 3-[[2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetyl]-methylamino]propyl nitrate |
|---|---|
| PubChem CID | 70353614 |
| Molecular Formula | C18H29N3O6 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 3-[[2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetyl]-methylamino]propyl nitrate |
| SMILES | CC(C)NCC(O)COc1ccc(CC(=O)N(C)CCCO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H29N3O6/c1-14(2)19-12-16(22)13-26-17-7-5-15(6-8-17)11-18(23)20(3)9-4-10-27-21(24)25/h5-8,14,16,19,22H,4,9-13H2,1-3H3 |
| InChIKey | YFANMPZUWNTOJG-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 114.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|