C13H20N2O5 — CID 13376602
[3-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]methyl nitrate (PubChem CID 13376602) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is [3-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]methyl nitrate.
| Compound Name | [3-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]methyl nitrate |
|---|---|
| PubChem CID | 13376602 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | [3-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]methyl nitrate |
| SMILES | CC(C)NCC(O)COc1cccc(CO[N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H20N2O5/c1-10(2)14-7-12(16)9-19-13-5-3-4-11(6-13)8-20-15(17)18/h3-6,10,12,14,16H,7-9H2,1-2H3 |
| InChIKey | LFSGVWJKBWYRPU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 93.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|