C12H18INO2 — CID 14099143
1-(3-iodophenoxy)-3-(propan-2-ylamino)propan-2-ol (PubChem CID 14099143) has the molecular formula C12H18INO2 and a molecular weight of 335.19 g/mol. Its IUPAC name is 1-(3-iodophenoxy)-3-(propan-2-ylamino)propan-2-ol.
| Compound Name | 1-(3-iodophenoxy)-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 14099143 |
| Molecular Formula | C12H18INO2 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 1-(3-iodophenoxy)-3-(propan-2-ylamino)propan-2-ol |
| SMILES | CC(C)NCC(O)COc1cccc(I)c1 |
| InChI | InChI=1S/C12H18INO2/c1-9(2)14-7-11(15)8-16-12-5-3-4-10(13)6-12/h3-6,9,11,14-15H,7-8H2,1-2H3 |
| InChIKey | BYKVWWXJHBNHGD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|