C16H25N2O4- — CID 57346235
N-[3-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-N-propylcarbamate (PubChem CID 57346235) has the molecular formula C16H25N2O4- and a molecular weight of 309.39 g/mol. Its IUPAC name is N-[3-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-N-propylcarbamate.
| Compound Name | N-[3-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 57346235 |
| Molecular Formula | C16H25N2O4- |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | N-[3-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-N-propylcarbamate |
| SMILES | CCCN(C(=O)[O-])c1cccc(OCC(O)CNC(C)C)c1 |
| InChI | InChI=1S/C16H26N2O4/c1-4-8-18(16(20)21)13-6-5-7-15(9-13)22-11-14(19)10-17-12(2)3/h5-7,9,12,14,17,19H,4,8,10-11H2,1-3H3,(H,20,21)/p-1 |
| InChIKey | BSDWYTRNKOCIPV-UHFFFAOYSA-M |
| XLogP | 0.98 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |