C13H21N3O6 — CID 13376622
2-[[6-[2-hydroxy-3-(propan-2-ylamino)propoxy]-2-pyridinyl]oxy]ethyl nitrate (PubChem CID 13376622) has the molecular formula C13H21N3O6 and a molecular weight of 315.33 g/mol. Its IUPAC name is 2-[[6-[2-hydroxy-3-(propan-2-ylamino)propoxy]-2-pyridinyl]oxy]ethyl nitrate.
| Compound Name | 2-[[6-[2-hydroxy-3-(propan-2-ylamino)propoxy]-2-pyridinyl]oxy]ethyl nitrate |
|---|---|
| PubChem CID | 13376622 |
| Molecular Formula | C13H21N3O6 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 2-[[6-[2-hydroxy-3-(propan-2-ylamino)propoxy]-2-pyridinyl]oxy]ethyl nitrate |
| SMILES | CC(C)NCC(O)COc1cccc(OCCO[N+](=O)[O-])n1 |
| InChI | InChI=1S/C13H21N3O6/c1-10(2)14-8-11(17)9-21-13-5-3-4-12(15-13)20-6-7-22-16(18)19/h3-5,10-11,14,17H,6-9H2,1-2H3 |
| InChIKey | PTCUSAYFCREEOG-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|