C19H31N3O6 — CID 70462566
4-[[2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetyl]-methylamino]butyl nitrate (PubChem CID 70462566) has the molecular formula C19H31N3O6 and a molecular weight of 397.47 g/mol. Its IUPAC name is 4-[[2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetyl]-methylamino]butyl nitrate.
| Compound Name | 4-[[2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetyl]-methylamino]butyl nitrate |
|---|---|
| PubChem CID | 70462566 |
| Molecular Formula | C19H31N3O6 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 4-[[2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetyl]-methylamino]butyl nitrate |
| SMILES | CC(C)NCC(O)COc1ccc(CC(=O)N(C)CCCCO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H31N3O6/c1-15(2)20-13-17(23)14-27-18-8-6-16(7-9-18)12-19(24)21(3)10-4-5-11-28-22(25)26/h6-9,15,17,20,23H,4-5,10-14H2,1-3H3 |
| InChIKey | DXKQCUIKWKEAJG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 114.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|