C17H27N3O6 — CID 70353310
2-[[2-[4-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]acetyl]amino]ethyl nitrate (PubChem CID 70353310) has the molecular formula C17H27N3O6 and a molecular weight of 369.42 g/mol. Its IUPAC name is 2-[[2-[4-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]acetyl]amino]ethyl nitrate.
| Compound Name | 2-[[2-[4-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]acetyl]amino]ethyl nitrate |
|---|---|
| PubChem CID | 70353310 |
| Molecular Formula | C17H27N3O6 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 2-[[2-[4-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]acetyl]amino]ethyl nitrate |
| SMILES | CC(C)(C)NCC(O)COc1ccc(CC(=O)NCCO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H27N3O6/c1-17(2,3)19-11-14(21)12-25-15-6-4-13(5-7-15)10-16(22)18-8-9-26-20(23)24/h4-7,14,19,21H,8-12H2,1-3H3,(H,18,22) |
| InChIKey | LQABXDDMZMRUDA-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 122.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|