C18H27ClN4O6 — CID 70395154
[4-[4-[3-(tert-butylamino)-2-hydroxypropoxy]anilino]-2-cyano-4-oxobutyl] nitrate;hydrochloride (PubChem CID 70395154) has the molecular formula C18H27ClN4O6 and a molecular weight of 430.89 g/mol. Its IUPAC name is [4-[4-[3-(tert-butylamino)-2-hydroxypropoxy]anilino]-2-cyano-4-oxobutyl] nitrate;hydrochloride.
| Compound Name | [4-[4-[3-(tert-butylamino)-2-hydroxypropoxy]anilino]-2-cyano-4-oxobutyl] nitrate;hydrochloride |
|---|---|
| PubChem CID | 70395154 |
| Molecular Formula | C18H27ClN4O6 |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | [4-[4-[3-(tert-butylamino)-2-hydroxypropoxy]anilino]-2-cyano-4-oxobutyl] nitrate;hydrochloride |
| SMILES | CC(C)(C)NCC(O)COc1ccc(NC(=O)CC(C#N)CO[N+](=O)[O-])cc1.Cl |
| InChI | InChI=1S/C18H26N4O6.ClH/c1-18(2,3)20-10-15(23)12-27-16-6-4-14(5-7-16)21-17(24)8-13(9-19)11-28-22(25)26;/h4-7,13,15,20,23H,8,10-12H2,1-3H3,(H,21,24);1H |
| InChIKey | QQVRUMKFKMRYSQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 146.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|