C17H27N3O7S — CID 70353112
2-[2-[4-[3-(tert-butylamino)-2-hydroxypropoxy]anilino]-2-oxoethyl]sulfinylethyl nitrate (PubChem CID 70353112) has the molecular formula C17H27N3O7S and a molecular weight of 417.48 g/mol. Its IUPAC name is 2-[2-[4-[3-(tert-butylamino)-2-hydroxypropoxy]anilino]-2-oxoethyl]sulfinylethyl nitrate.
| Compound Name | 2-[2-[4-[3-(tert-butylamino)-2-hydroxypropoxy]anilino]-2-oxoethyl]sulfinylethyl nitrate |
|---|---|
| PubChem CID | 70353112 |
| Molecular Formula | C17H27N3O7S |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 2-[2-[4-[3-(tert-butylamino)-2-hydroxypropoxy]anilino]-2-oxoethyl]sulfinylethyl nitrate |
| SMILES | CC(C)(C)NCC(O)COc1ccc(NC(=O)CS(=O)CCO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H27N3O7S/c1-17(2,3)18-10-14(21)11-26-15-6-4-13(5-7-15)19-16(22)12-28(25)9-8-27-20(23)24/h4-7,14,18,21H,8-12H2,1-3H3,(H,19,22) |
| InChIKey | HAKXFSFSUBMEFA-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|