C19H32N2O8 — CID 89013729
[1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-yl] 2-[2-(dihydroxyamino)oxyethoxy]acetate (PubChem CID 89013729) has the molecular formula C19H32N2O8 and a molecular weight of 416.47 g/mol. Its IUPAC name is [1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-yl] 2-[2-(dihydroxyamino)oxyethoxy]acetate.
| Compound Name | [1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-yl] 2-[2-(dihydroxyamino)oxyethoxy]acetate |
|---|---|
| PubChem CID | 89013729 |
| Molecular Formula | C19H32N2O8 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | [1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-yl] 2-[2-(dihydroxyamino)oxyethoxy]acetate |
| SMILES | COCCc1ccc(OCC(CNC(C)C)OC(=O)COCCON(O)O)cc1 |
| InChI | InChI=1S/C19H32N2O8/c1-15(2)20-12-18(29-19(22)14-26-10-11-28-21(23)24)13-27-17-6-4-16(5-7-17)8-9-25-3/h4-7,15,18,20,23-24H,8-14H2,1-3H3 |
| InChIKey | MDNBJFIAPLXGLX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|