C20H32N2O9 — CID 89013739
methyl 3-[4-[3-[[2-[2-(dihydroxyamino)oxyethoxy]acetyl]-propan-2-ylamino]-2-hydroxypropoxy]phenyl]propanoate (PubChem CID 89013739) has the molecular formula C20H32N2O9 and a molecular weight of 444.48 g/mol. Its IUPAC name is methyl 3-[4-[3-[[2-[2-(dihydroxyamino)oxyethoxy]acetyl]-propan-2-ylamino]-2-hydroxypropoxy]phenyl]propanoate.
| Compound Name | methyl 3-[4-[3-[[2-[2-(dihydroxyamino)oxyethoxy]acetyl]-propan-2-ylamino]-2-hydroxypropoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 89013739 |
| Molecular Formula | C20H32N2O9 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | methyl 3-[4-[3-[[2-[2-(dihydroxyamino)oxyethoxy]acetyl]-propan-2-ylamino]-2-hydroxypropoxy]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(OCC(O)CN(C(=O)COCCON(O)O)C(C)C)cc1 |
| InChI | InChI=1S/C20H32N2O9/c1-15(2)21(19(24)14-29-10-11-31-22(26)27)12-17(23)13-30-18-7-4-16(5-8-18)6-9-20(25)28-3/h4-5,7-8,15,17,23,26-27H,6,9-14H2,1-3H3 |
| InChIKey | HKULPBODAFUCNX-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 138.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|