C21H34N2O9 — CID 89372559
[2-[[2-hydroxy-3-[4-(2-propan-2-yloxyethoxymethyl)phenoxy]propyl]-propan-2-ylamino]-2-oxoethoxy]methyl nitrate (PubChem CID 89372559) has the molecular formula C21H34N2O9 and a molecular weight of 458.51 g/mol. Its IUPAC name is [2-[[2-hydroxy-3-[4-(2-propan-2-yloxyethoxymethyl)phenoxy]propyl]-propan-2-ylamino]-2-oxoethoxy]methyl nitrate.
| Compound Name | [2-[[2-hydroxy-3-[4-(2-propan-2-yloxyethoxymethyl)phenoxy]propyl]-propan-2-ylamino]-2-oxoethoxy]methyl nitrate |
|---|---|
| PubChem CID | 89372559 |
| Molecular Formula | C21H34N2O9 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | [2-[[2-hydroxy-3-[4-(2-propan-2-yloxyethoxymethyl)phenoxy]propyl]-propan-2-ylamino]-2-oxoethoxy]methyl nitrate |
| SMILES | CC(C)OCCOCc1ccc(OCC(O)CN(C(=O)COCO[N+](=O)[O-])C(C)C)cc1 |
| InChI | InChI=1S/C21H34N2O9/c1-16(2)22(21(25)14-29-15-32-23(26)27)11-19(24)13-31-20-7-5-18(6-8-20)12-28-9-10-30-17(3)4/h5-8,16-17,19,24H,9-15H2,1-4H3 |
| InChIKey | KWQADPGPHYPHCA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 129.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|