C19H30N2O9 — CID 89013724
methyl 3-[4-[3-[[2-[(dihydroxyamino)oxymethoxy]acetyl]-propan-2-ylamino]-2-hydroxypropoxy]phenyl]propanoate (PubChem CID 89013724) has the molecular formula C19H30N2O9 and a molecular weight of 430.45 g/mol. Its IUPAC name is methyl 3-[4-[3-[[2-[(dihydroxyamino)oxymethoxy]acetyl]-propan-2-ylamino]-2-hydroxypropoxy]phenyl]propanoate.
| Compound Name | methyl 3-[4-[3-[[2-[(dihydroxyamino)oxymethoxy]acetyl]-propan-2-ylamino]-2-hydroxypropoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 89013724 |
| Molecular Formula | C19H30N2O9 |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | methyl 3-[4-[3-[[2-[(dihydroxyamino)oxymethoxy]acetyl]-propan-2-ylamino]-2-hydroxypropoxy]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(OCC(O)CN(C(=O)COCON(O)O)C(C)C)cc1 |
| InChI | InChI=1S/C19H30N2O9/c1-14(2)20(18(23)12-28-13-30-21(25)26)10-16(22)11-29-17-7-4-15(5-8-17)6-9-19(24)27-3/h4-5,7-8,14,16,22,25-26H,6,9-13H2,1-3H3 |
| InChIKey | GQJNWBQLWKDAIG-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 138.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|