C20H30N2O9 — CID 11282169
methyl 3-[4-[2-hydroxy-3-[[2-(2-nitrooxyethoxy)acetyl]-propan-2-ylamino]propoxy]phenyl]propanoate (PubChem CID 11282169) has the molecular formula C20H30N2O9 and a molecular weight of 442.47 g/mol. Its IUPAC name is methyl 3-[4-[2-hydroxy-3-[[2-(2-nitrooxyethoxy)acetyl]-propan-2-ylamino]propoxy]phenyl]propanoate.
| Compound Name | methyl 3-[4-[2-hydroxy-3-[[2-(2-nitrooxyethoxy)acetyl]-propan-2-ylamino]propoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 11282169 |
| Molecular Formula | C20H30N2O9 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | methyl 3-[4-[2-hydroxy-3-[[2-(2-nitrooxyethoxy)acetyl]-propan-2-ylamino]propoxy]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(OCC(O)CN(C(=O)COCCO[N+](=O)[O-])C(C)C)cc1 |
| InChI | InChI=1S/C20H30N2O9/c1-15(2)21(19(24)14-29-10-11-31-22(26)27)12-17(23)13-30-18-7-4-16(5-8-18)6-9-20(25)28-3/h4-5,7-8,15,17,23H,6,9-14H2,1-3H3 |
| InChIKey | PHVSKMGSRXTFJY-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 137.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|