C26H36N2O8 — CID 11202917
[4-[[2-hydroxy-3-[4-(2-propan-2-yloxyethoxymethyl)phenoxy]propyl]-propan-2-ylcarbamoyl]phenyl]methyl nitrate (PubChem CID 11202917) has the molecular formula C26H36N2O8 and a molecular weight of 504.58 g/mol. Its IUPAC name is [4-[[2-hydroxy-3-[4-(2-propan-2-yloxyethoxymethyl)phenoxy]propyl]-propan-2-ylcarbamoyl]phenyl]methyl nitrate.
| Compound Name | [4-[[2-hydroxy-3-[4-(2-propan-2-yloxyethoxymethyl)phenoxy]propyl]-propan-2-ylcarbamoyl]phenyl]methyl nitrate |
|---|---|
| PubChem CID | 11202917 |
| Molecular Formula | C26H36N2O8 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | [4-[[2-hydroxy-3-[4-(2-propan-2-yloxyethoxymethyl)phenoxy]propyl]-propan-2-ylcarbamoyl]phenyl]methyl nitrate |
| SMILES | CC(C)OCCOCc1ccc(OCC(O)CN(C(=O)c2ccc(CO[N+](=O)[O-])cc2)C(C)C)cc1 |
| InChI | InChI=1S/C26H36N2O8/c1-19(2)27(26(30)23-9-5-22(6-10-23)17-36-28(31)32)15-24(29)18-35-25-11-7-21(8-12-25)16-33-13-14-34-20(3)4/h5-12,19-20,24,29H,13-18H2,1-4H3 |
| InChIKey | GGCQXNDFNNOTTG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|