C22H38N2O9 — CID 89013807
2-[2-(dihydroxyamino)oxyethoxy]-N-[2-hydroxy-3-[4-(2-propan-2-yloxyethoxymethyl)phenoxy]propyl]-N-propan-2-ylacetamide (PubChem CID 89013807) has the molecular formula C22H38N2O9 and a molecular weight of 474.55 g/mol. Its IUPAC name is 2-[2-(dihydroxyamino)oxyethoxy]-N-[2-hydroxy-3-[4-(2-propan-2-yloxyethoxymethyl)phenoxy]propyl]-N-propan-2-ylacetamide.
| Compound Name | 2-[2-(dihydroxyamino)oxyethoxy]-N-[2-hydroxy-3-[4-(2-propan-2-yloxyethoxymethyl)phenoxy]propyl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 89013807 |
| Molecular Formula | C22H38N2O9 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 2-[2-(dihydroxyamino)oxyethoxy]-N-[2-hydroxy-3-[4-(2-propan-2-yloxyethoxymethyl)phenoxy]propyl]-N-propan-2-ylacetamide |
| SMILES | CC(C)OCCOCc1ccc(OCC(O)CN(C(=O)COCCON(O)O)C(C)C)cc1 |
| InChI | InChI=1S/C22H38N2O9/c1-17(2)23(22(26)16-30-10-12-33-24(27)28)13-20(25)15-32-21-7-5-19(6-8-21)14-29-9-11-31-18(3)4/h5-8,17-18,20,25,27-28H,9-16H2,1-4H3 |
| InChIKey | BEFPAUXYXXJRJT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|