C17H28N2O3 — CID 59432769
2-[4-[3-[di(propan-2-yl)amino]-2-hydroxypropoxy]phenyl]acetamide (PubChem CID 59432769) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is 2-[4-[3-[di(propan-2-yl)amino]-2-hydroxypropoxy]phenyl]acetamide.
| Compound Name | 2-[4-[3-[di(propan-2-yl)amino]-2-hydroxypropoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 59432769 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 2-[4-[3-[di(propan-2-yl)amino]-2-hydroxypropoxy]phenyl]acetamide |
| SMILES | CC(C)N(CC(O)COc1ccc(CC(N)=O)cc1)C(C)C |
| InChI | InChI=1S/C17H28N2O3/c1-12(2)19(13(3)4)10-15(20)11-22-16-7-5-14(6-8-16)9-17(18)21/h5-8,12-13,15,20H,9-11H2,1-4H3,(H2,18,21) |
| InChIKey | XVNUFANOHYGYOJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |