C15H20N2O5 — CID 95762944
ethyl (2S)-2-[[2-[4-(2-amino-2-oxoethyl)phenoxy]acetyl]amino]propanoate (PubChem CID 95762944) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is ethyl (2S)-2-[[2-[4-(2-amino-2-oxoethyl)phenoxy]acetyl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[2-[4-(2-amino-2-oxoethyl)phenoxy]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 95762944 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | ethyl (2S)-2-[[2-[4-(2-amino-2-oxoethyl)phenoxy]acetyl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NC(=O)COc1ccc(CC(N)=O)cc1 |
| InChI | InChI=1S/C15H20N2O5/c1-3-21-15(20)10(2)17-14(19)9-22-12-6-4-11(5-7-12)8-13(16)18/h4-7,10H,3,8-9H2,1-2H3,(H2,16,18)(H,17,19)/t10-/m0/s1 |
| InChIKey | FVNQNRNJOUFNIX-JTQLQIEISA-N |
| XLogP | 0.16 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |