C18H18NO5- — CID 2333588
(2R)-2-[[2-[4-(4-methylphenoxy)phenoxy]acetyl]amino]propanoate (PubChem CID 2333588) has the molecular formula C18H18NO5- and a molecular weight of 328.34 g/mol. Its IUPAC name is (2R)-2-[[2-[4-(4-methylphenoxy)phenoxy]acetyl]amino]propanoate.
| Compound Name | (2R)-2-[[2-[4-(4-methylphenoxy)phenoxy]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 2333588 |
| Molecular Formula | C18H18NO5- |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | (2R)-2-[[2-[4-(4-methylphenoxy)phenoxy]acetyl]amino]propanoate |
| SMILES | Cc1ccc(Oc2ccc(OCC(=O)N[C@H](C)C(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C18H19NO5/c1-12-3-5-15(6-4-12)24-16-9-7-14(8-10-16)23-11-17(20)19-13(2)18(21)22/h3-10,13H,11H2,1-2H3,(H,19,20)(H,21,22)/p-1/t13-/m1/s1 |
| InChIKey | XJWMUVBMFSSRMF-CYBMUJFWSA-M |
| XLogP | 1.42 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |