C16H22NO4- — CID 9156981
(2R)-2-[[2-[4-(2-methylbutan-2-yl)phenoxy]acetyl]amino]propanoate (PubChem CID 9156981) has the molecular formula C16H22NO4- and a molecular weight of 292.36 g/mol. Its IUPAC name is (2R)-2-[[2-[4-(2-methylbutan-2-yl)phenoxy]acetyl]amino]propanoate.
| Compound Name | (2R)-2-[[2-[4-(2-methylbutan-2-yl)phenoxy]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 9156981 |
| Molecular Formula | C16H22NO4- |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | (2R)-2-[[2-[4-(2-methylbutan-2-yl)phenoxy]acetyl]amino]propanoate |
| SMILES | CCC(C)(C)c1ccc(OCC(=O)N[C@H](C)C(=O)[O-])cc1 |
| InChI | InChI=1S/C16H23NO4/c1-5-16(3,4)12-6-8-13(9-7-12)21-10-14(18)17-11(2)15(19)20/h6-9,11H,5,10H2,1-4H3,(H,17,18)(H,19,20)/p-1/t11-/m1/s1 |
| InChIKey | UGSLYMDQLLUBQF-LLVKDONJSA-M |
| XLogP | 1.01 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |