C19H31NO2 — CID 53283030
2-(4-tert-butylphenoxy)-N-(2,4-dimethylpentan-3-yl)acetamide (PubChem CID 53283030) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N-(2,4-dimethylpentan-3-yl)acetamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N-(2,4-dimethylpentan-3-yl)acetamide |
|---|---|
| PubChem CID | 53283030 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N-(2,4-dimethylpentan-3-yl)acetamide |
| SMILES | CC(C)C(NC(=O)COc1ccc(C(C)(C)C)cc1)C(C)C |
| InChI | InChI=1S/C19H31NO2/c1-13(2)18(14(3)4)20-17(21)12-22-16-10-8-15(9-11-16)19(5,6)7/h8-11,13-14,18H,12H2,1-7H3,(H,20,21) |
| InChIKey | JHULOVPUOGBYMG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |