C15H20NO5- — CID 2334247
(2S)-2-[[2-[3-(2-methylpropoxy)phenoxy]acetyl]amino]propanoate (PubChem CID 2334247) has the molecular formula C15H20NO5- and a molecular weight of 294.33 g/mol. Its IUPAC name is (2S)-2-[[2-[3-(2-methylpropoxy)phenoxy]acetyl]amino]propanoate.
| Compound Name | (2S)-2-[[2-[3-(2-methylpropoxy)phenoxy]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 2334247 |
| Molecular Formula | C15H20NO5- |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (2S)-2-[[2-[3-(2-methylpropoxy)phenoxy]acetyl]amino]propanoate |
| SMILES | CC(C)COc1cccc(OCC(=O)N[C@@H](C)C(=O)[O-])c1 |
| InChI | InChI=1S/C15H21NO5/c1-10(2)8-20-12-5-4-6-13(7-12)21-9-14(17)16-11(3)15(18)19/h4-7,10-11H,8-9H2,1-3H3,(H,16,17)(H,18,19)/p-1/t11-/m0/s1 |
| InChIKey | WVJLAWATIFDIGW-NSHDSACASA-M |
| XLogP | 0.35 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |