About [1-[di(propan-2-yl)amino]-3-phenoxypropan-2-yl] 2-phenylacetate
[1-[di(propan-2-yl)amino]-3-phenoxypropan-2-yl] 2-phenylacetate (PubChem CID 117068716) has the molecular formula C23H31NO3
and a molecular weight of 369.50 g/mol. Its IUPAC name is [1-[di(propan-2-yl)amino]-3-phenoxypropan-2-yl] 2-phenylacetate.
Molecular Properties
| Compound Name | [1-[di(propan-2-yl)amino]-3-phenoxypropan-2-yl] 2-phenylacetate |
| PubChem CID | 117068716 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | [1-[di(propan-2-yl)amino]-3-phenoxypropan-2-yl] 2-phenylacetate |
| SMILES | CC(C)N(CC(COc1ccccc1)OC(=O)Cc1ccccc1)C(C)C |
| InChI | InChI=1S/C23H31NO3/c1-18(2)24(19(3)4)16-22(17-26-21-13-9-6-10-14-21)27-23(25)15-20-11-7-5-8-12-20/h5-14,18-19,22H,15-17H2,1-4H3 |
| InChIKey | OFALHIWDYWGGFE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[di(propan-2-yl)amino]-3-phenoxypropan-2-yl] 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[di(propan-2-yl)amino]-3-phenoxypropan-2-yl] 2-phenylacetate?
The IUPAC name of [1-[di(propan-2-yl)amino]-3-phenoxypropan-2-yl] 2-phenylacetate (CID 117068716) is [1-[di(propan-2-yl)amino]-3-phenoxypropan-2-yl] 2-phenylacetate.
What is the SMILES notation for [1-[di(propan-2-yl)amino]-3-phenoxypropan-2-yl] 2-phenylacetate?
The canonical SMILES for [1-[di(propan-2-yl)amino]-3-phenoxypropan-2-yl] 2-phenylacetate is CC(C)N(CC(COc1ccccc1)OC(=O)Cc1ccccc1)C(C)C.
What is the InChIKey of [1-[di(propan-2-yl)amino]-3-phenoxypropan-2-yl] 2-phenylacetate?
The InChIKey is OFALHIWDYWGGFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31NO3/c1-18(2)24(19(3)4)16-22(17-26-21-13-9-6-10-14-21)27-23(25)15-20-11-7-5-8-12-20/h5-14,18-19,22H,15-17H2,1-4H3.
What are the key properties of [1-[di(propan-2-yl)amino]-3-phenoxypropan-2-yl] 2-phenylacetate?
[1-[di(propan-2-yl)amino]-3-phenoxypropan-2-yl] 2-phenylacetate has a molecular weight of 369.50 g/mol, XLogP of 4.34, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[di(propan-2-yl)amino]-3-phenoxypropan-2-yl] 2-phenylacetate is sourced from PubChem (CID 117068716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).