C14H22N2O7S — CID 139595490
2-[[3-[4-(2-amino-2-oxoethyl)phenoxy]-2-hydroxypropyl]amino]propyl hydrogen sulfate (PubChem CID 139595490) has the molecular formula C14H22N2O7S and a molecular weight of 362.40 g/mol. Its IUPAC name is 2-[[3-[4-(2-amino-2-oxoethyl)phenoxy]-2-hydroxypropyl]amino]propyl hydrogen sulfate.
| Compound Name | 2-[[3-[4-(2-amino-2-oxoethyl)phenoxy]-2-hydroxypropyl]amino]propyl hydrogen sulfate |
|---|---|
| PubChem CID | 139595490 |
| Molecular Formula | C14H22N2O7S |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 2-[[3-[4-(2-amino-2-oxoethyl)phenoxy]-2-hydroxypropyl]amino]propyl hydrogen sulfate |
| SMILES | CC(COS(=O)(=O)O)NCC(O)COc1ccc(CC(N)=O)cc1 |
| InChI | InChI=1S/C14H22N2O7S/c1-10(8-23-24(19,20)21)16-7-12(17)9-22-13-4-2-11(3-5-13)6-14(15)18/h2-5,10,12,16-17H,6-9H2,1H3,(H2,15,18)(H,19,20,21) |
| InChIKey | IVFRXEVEFVEYIC-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|