C25H36NO3+ — CID 10436866
[2-hydroxy-3-[2-(3-phenylpropanoyl)phenoxy]propyl]-methyl-di(propan-2-yl)azanium (PubChem CID 10436866) has the molecular formula C25H36NO3+ and a molecular weight of 398.57 g/mol. Its IUPAC name is [2-hydroxy-3-[2-(3-phenylpropanoyl)phenoxy]propyl]-methyl-di(propan-2-yl)azanium.
| Compound Name | [2-hydroxy-3-[2-(3-phenylpropanoyl)phenoxy]propyl]-methyl-di(propan-2-yl)azanium |
|---|---|
| PubChem CID | 10436866 |
| Molecular Formula | C25H36NO3+ |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | [2-hydroxy-3-[2-(3-phenylpropanoyl)phenoxy]propyl]-methyl-di(propan-2-yl)azanium |
| SMILES | CC(C)[N+](C)(CC(O)COc1ccccc1C(=O)CCc1ccccc1)C(C)C |
| InChI | InChI=1S/C25H36NO3/c1-19(2)26(5,20(3)4)17-22(27)18-29-25-14-10-9-13-23(25)24(28)16-15-21-11-7-6-8-12-21/h6-14,19-20,22,27H,15-18H2,1-5H3/q+1 |
| InChIKey | CIFTXCZRWDDNPN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|