C23H32NO6P — CID 58600610
1-[2-[3-[dimethoxyphosphoryl(propyl)amino]-2-hydroxypropoxy]phenyl]-3-phenylpropan-1-one (PubChem CID 58600610) has the molecular formula C23H32NO6P and a molecular weight of 449.48 g/mol. Its IUPAC name is 1-[2-[3-[dimethoxyphosphoryl(propyl)amino]-2-hydroxypropoxy]phenyl]-3-phenylpropan-1-one.
| Compound Name | 1-[2-[3-[dimethoxyphosphoryl(propyl)amino]-2-hydroxypropoxy]phenyl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 58600610 |
| Molecular Formula | C23H32NO6P |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 1-[2-[3-[dimethoxyphosphoryl(propyl)amino]-2-hydroxypropoxy]phenyl]-3-phenylpropan-1-one |
| SMILES | CCCN(CC(O)COc1ccccc1C(=O)CCc1ccccc1)P(=O)(OC)OC |
| InChI | InChI=1S/C23H32NO6P/c1-4-16-24(31(27,28-2)29-3)17-20(25)18-30-23-13-9-8-12-21(23)22(26)15-14-19-10-6-5-7-11-19/h5-13,20,25H,4,14-18H2,1-3H3 |
| InChIKey | XKBRHJTUDFHSHR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|