C18H18F2N2O7 — CID 88822775
2-[3-(difluoromethyl)-4-(2,3-dihydroxypropoxy)-2-methyl-5-nitroanilino]benzoic acid (PubChem CID 88822775) has the molecular formula C18H18F2N2O7 and a molecular weight of 412.35 g/mol. Its IUPAC name is 2-[3-(difluoromethyl)-4-(2,3-dihydroxypropoxy)-2-methyl-5-nitroanilino]benzoic acid.
| Compound Name | 2-[3-(difluoromethyl)-4-(2,3-dihydroxypropoxy)-2-methyl-5-nitroanilino]benzoic acid |
|---|---|
| PubChem CID | 88822775 |
| Molecular Formula | C18H18F2N2O7 |
| Molecular Weight | 412.35 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 2-[3-(difluoromethyl)-4-(2,3-dihydroxypropoxy)-2-methyl-5-nitroanilino]benzoic acid |
| SMILES | Cc1c(Nc2ccccc2C(=O)O)cc([N+](=O)[O-])c(OCC(O)CO)c1C(F)F |
| InChI | InChI=1S/C18H18F2N2O7/c1-9-13(21-12-5-3-2-4-11(12)18(25)26)6-14(22(27)28)16(15(9)17(19)20)29-8-10(24)7-23/h2-6,10,17,21,23-24H,7-8H2,1H3,(H,25,26) |
| InChIKey | NAVIQBQHPUOEJB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 142.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|