C9H6BrF2NO — CID 107277090
2-bromo-4-(2,2-difluoroethoxy)benzonitrile (PubChem CID 107277090) has the molecular formula C9H6BrF2NO and a molecular weight of 262.05 g/mol. Its IUPAC name is 2-bromo-4-(2,2-difluoroethoxy)benzonitrile.
| Compound Name | 2-bromo-4-(2,2-difluoroethoxy)benzonitrile |
|---|---|
| PubChem CID | 107277090 |
| Molecular Formula | C9H6BrF2NO |
| Molecular Weight | 262.05 g/mol |
| Exact Mass | 260.96 |
| IUPAC Name | 2-bromo-4-(2,2-difluoroethoxy)benzonitrile |
| SMILES | N#Cc1ccc(OCC(F)F)cc1Br |
| InChI | InChI=1S/C9H6BrF2NO/c10-8-3-7(14-5-9(11)12)2-1-6(8)4-13/h1-3,9H,5H2 |
| InChIKey | KZHFOMSOFRGLNR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.05 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |