C8H6F2N2O — CID 71758116
4-(2,2-difluoroethoxy)pyridine-2-carbonitrile (PubChem CID 71758116) has the molecular formula C8H6F2N2O and a molecular weight of 184.15 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)pyridine-2-carbonitrile.
| Compound Name | 4-(2,2-difluoroethoxy)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 71758116 |
| Molecular Formula | C8H6F2N2O |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 4-(2,2-difluoroethoxy)pyridine-2-carbonitrile |
| SMILES | N#Cc1cc(OCC(F)F)ccn1 |
| InChI | InChI=1S/C8H6F2N2O/c9-8(10)5-13-7-1-2-12-6(3-7)4-11/h1-3,8H,5H2 |
| InChIKey | FHKQQGCEWQZOGR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |