C10H13BrFNO3S — CID 83234776
3-(3-bromo-4-fluorophenoxy)-2-methylpropane-1-sulfonamide (PubChem CID 83234776) has the molecular formula C10H13BrFNO3S and a molecular weight of 326.19 g/mol. Its IUPAC name is 3-(3-bromo-4-fluorophenoxy)-2-methylpropane-1-sulfonamide.
| Compound Name | 3-(3-bromo-4-fluorophenoxy)-2-methylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 83234776 |
| Molecular Formula | C10H13BrFNO3S |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 324.98 |
| IUPAC Name | 3-(3-bromo-4-fluorophenoxy)-2-methylpropane-1-sulfonamide |
| SMILES | CC(COc1ccc(F)c(Br)c1)CS(N)(=O)=O |
| InChI | InChI=1S/C10H13BrFNO3S/c1-7(6-17(13,14)15)5-16-8-2-3-10(12)9(11)4-8/h2-4,7H,5-6H2,1H3,(H2,13,14,15) |
| InChIKey | UUGCWVSCOWJLQT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |