C12H17BrFNO3S — CID 83234940
5-(3-bromo-4-fluorophenoxy)-3-methylpentane-1-sulfonamide (PubChem CID 83234940) has the molecular formula C12H17BrFNO3S and a molecular weight of 354.24 g/mol. Its IUPAC name is 5-(3-bromo-4-fluorophenoxy)-3-methylpentane-1-sulfonamide.
| Compound Name | 5-(3-bromo-4-fluorophenoxy)-3-methylpentane-1-sulfonamide |
|---|---|
| PubChem CID | 83234940 |
| Molecular Formula | C12H17BrFNO3S |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | 5-(3-bromo-4-fluorophenoxy)-3-methylpentane-1-sulfonamide |
| SMILES | CC(CCOc1ccc(F)c(Br)c1)CCS(N)(=O)=O |
| InChI | InChI=1S/C12H17BrFNO3S/c1-9(5-7-19(15,16)17)4-6-18-10-2-3-12(14)11(13)8-10/h2-3,8-9H,4-7H2,1H3,(H2,15,16,17) |
| InChIKey | ZEGWXDWPHQCDDZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |