C12H14BrFO3 — CID 91636277
2-[2-(5-bromo-2-fluorophenoxy)ethyl]-1,3-dioxane (PubChem CID 91636277) has the molecular formula C12H14BrFO3 and a molecular weight of 305.14 g/mol. Its IUPAC name is 2-[2-(5-bromo-2-fluorophenoxy)ethyl]-1,3-dioxane.
| Compound Name | 2-[2-(5-bromo-2-fluorophenoxy)ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 91636277 |
| Molecular Formula | C12H14BrFO3 |
| Molecular Weight | 305.14 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 2-[2-(5-bromo-2-fluorophenoxy)ethyl]-1,3-dioxane |
| SMILES | Fc1ccc(Br)cc1OCCC1OCCCO1 |
| InChI | InChI=1S/C12H14BrFO3/c13-9-2-3-10(14)11(8-9)15-7-4-12-16-5-1-6-17-12/h2-3,8,12H,1,4-7H2 |
| InChIKey | UBRPTFOYBBOBGV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.14 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |