C13H17ClO3 — CID 66474760
2-[2-(4-chloro-2-methylphenoxy)ethyl]-1,3-dioxane (PubChem CID 66474760) has the molecular formula C13H17ClO3 and a molecular weight of 256.73 g/mol. Its IUPAC name is 2-[2-(4-chloro-2-methylphenoxy)ethyl]-1,3-dioxane.
| Compound Name | 2-[2-(4-chloro-2-methylphenoxy)ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 66474760 |
| Molecular Formula | C13H17ClO3 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 2-[2-(4-chloro-2-methylphenoxy)ethyl]-1,3-dioxane |
| SMILES | Cc1cc(Cl)ccc1OCCC1OCCCO1 |
| InChI | InChI=1S/C13H17ClO3/c1-10-9-11(14)3-4-12(10)15-8-5-13-16-6-2-7-17-13/h3-4,9,13H,2,5-8H2,1H3 |
| InChIKey | YSTPLSZYPFXXDL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |