C13H18O3 — CID 66475164
2-[2-(2-methylphenoxy)ethyl]-1,3-dioxane (PubChem CID 66475164) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 2-[2-(2-methylphenoxy)ethyl]-1,3-dioxane.
| Compound Name | 2-[2-(2-methylphenoxy)ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 66475164 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 2-[2-(2-methylphenoxy)ethyl]-1,3-dioxane |
| SMILES | Cc1ccccc1OCCC1OCCCO1 |
| InChI | InChI=1S/C13H18O3/c1-11-5-2-3-6-12(11)14-10-7-13-15-8-4-9-16-13/h2-3,5-6,13H,4,7-10H2,1H3 |
| InChIKey | FMMRJZWLGPLXMG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |