C18H26O5 — CID 146319161
propan-2-yl 3-[2-[2-(1,3-dioxan-2-yl)ethoxy]phenyl]propanoate (PubChem CID 146319161) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is propan-2-yl 3-[2-[2-(1,3-dioxan-2-yl)ethoxy]phenyl]propanoate.
| Compound Name | propan-2-yl 3-[2-[2-(1,3-dioxan-2-yl)ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 146319161 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | propan-2-yl 3-[2-[2-(1,3-dioxan-2-yl)ethoxy]phenyl]propanoate |
| SMILES | CC(C)OC(=O)CCc1ccccc1OCCC1OCCCO1 |
| InChI | InChI=1S/C18H26O5/c1-14(2)23-17(19)9-8-15-6-3-4-7-16(15)20-13-10-18-21-11-5-12-22-18/h3-4,6-7,14,18H,5,8-13H2,1-2H3 |
| InChIKey | VKAYMPQMKOWFLD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |