propan-2-yl 3-[2-[2-(1,3-dioxan-2-yl)ethoxy]phenyl]propanoate

C18H26O5 — CID 146319161

IUPACpropan-2-yl 3-[2-[2-(1,3-dioxan-2-yl)ethoxy]phenyl]propanoate
SMILESCC(C)OC(=O)CCc1ccccc1OCCC1OCCCO1
InChIInChI=1S/C18H26O5/c1-14(2)23-17(19)9-8-15-6-3-4-7-16(15)20-13-10-18-21-11-5-12-22-18/h3-4,6-7,14,18H,5,8-13H2,1-2H3
InChIKeyVKAYMPQMKOWFLD-UHFFFAOYSA-N
MW322.40 g/mol
LogP3.10
Rot. Bonds8

About propan-2-yl 3-[2-[2-(1,3-dioxan-2-yl)ethoxy]phenyl]propanoate

propan-2-yl 3-[2-[2-(1,3-dioxan-2-yl)ethoxy]phenyl]propanoate (PubChem CID 146319161) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is propan-2-yl 3-[2-[2-(1,3-dioxan-2-yl)ethoxy]phenyl]propanoate.

Molecular Properties

Compound Namepropan-2-yl 3-[2-[2-(1,3-dioxan-2-yl)ethoxy]phenyl]propanoate
PubChem CID146319161
Molecular FormulaC18H26O5
Molecular Weight322.40 g/mol
Exact Mass322.18
IUPAC Namepropan-2-yl 3-[2-[2-(1,3-dioxan-2-yl)ethoxy]phenyl]propanoate
SMILESCC(C)OC(=O)CCc1ccccc1OCCC1OCCCO1
InChIInChI=1S/C18H26O5/c1-14(2)23-17(19)9-8-15-6-3-4-7-16(15)20-13-10-18-21-11-5-12-22-18/h3-4,6-7,14,18H,5,8-13H2,1-2H3
InChIKeyVKAYMPQMKOWFLD-UHFFFAOYSA-N
XLogP3.10
TPSA53.99 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500322.40
LogP ≤ 53.10
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze propan-2-yl 3-[2-[2-(1,3-dioxan-2-yl)ethoxy]phenyl]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of propan-2-yl 3-[2-[2-(1,3-dioxan-2-yl)ethoxy]phenyl]propanoate?
The IUPAC name of propan-2-yl 3-[2-[2-(1,3-dioxan-2-yl)ethoxy]phenyl]propanoate (CID 146319161) is propan-2-yl 3-[2-[2-(1,3-dioxan-2-yl)ethoxy]phenyl]propanoate.
What is the SMILES notation for propan-2-yl 3-[2-[2-(1,3-dioxan-2-yl)ethoxy]phenyl]propanoate?
The canonical SMILES for propan-2-yl 3-[2-[2-(1,3-dioxan-2-yl)ethoxy]phenyl]propanoate is CC(C)OC(=O)CCc1ccccc1OCCC1OCCCO1.
What is the InChIKey of propan-2-yl 3-[2-[2-(1,3-dioxan-2-yl)ethoxy]phenyl]propanoate?
The InChIKey is VKAYMPQMKOWFLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O5/c1-14(2)23-17(19)9-8-15-6-3-4-7-16(15)20-13-10-18-21-11-5-12-22-18/h3-4,6-7,14,18H,5,8-13H2,1-2H3.
What are the key properties of propan-2-yl 3-[2-[2-(1,3-dioxan-2-yl)ethoxy]phenyl]propanoate?
propan-2-yl 3-[2-[2-(1,3-dioxan-2-yl)ethoxy]phenyl]propanoate has a molecular weight of 322.40 g/mol, XLogP of 3.10, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 3-[2-[2-(1,3-dioxan-2-yl)ethoxy]phenyl]propanoate is sourced from PubChem (CID 146319161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).