C20H30O4Si — CID 175152117
propan-2-yl 3-[2-(3-trimethylsilyloxypent-4-ynoxy)phenyl]propanoate (PubChem CID 175152117) has the molecular formula C20H30O4Si and a molecular weight of 362.54 g/mol. Its IUPAC name is propan-2-yl 3-[2-(3-trimethylsilyloxypent-4-ynoxy)phenyl]propanoate.
| Compound Name | propan-2-yl 3-[2-(3-trimethylsilyloxypent-4-ynoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 175152117 |
| Molecular Formula | C20H30O4Si |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | propan-2-yl 3-[2-(3-trimethylsilyloxypent-4-ynoxy)phenyl]propanoate |
| SMILES | C#CC(CCOc1ccccc1CCC(=O)OC(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C20H30O4Si/c1-7-18(24-25(4,5)6)14-15-22-19-11-9-8-10-17(19)12-13-20(21)23-16(2)3/h1,8-11,16,18H,12-15H2,2-6H3 |
| InChIKey | IMQDVVMRXHFVPA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|