C23H25NO6 — CID 175545314
propan-2-yl 3-[2-[5-(3-nitrophenyl)-3-oxopent-4-enoxy]phenyl]propanoate (PubChem CID 175545314) has the molecular formula C23H25NO6 and a molecular weight of 411.45 g/mol. Its IUPAC name is propan-2-yl 3-[2-[5-(3-nitrophenyl)-3-oxopent-4-enoxy]phenyl]propanoate.
| Compound Name | propan-2-yl 3-[2-[5-(3-nitrophenyl)-3-oxopent-4-enoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 175545314 |
| Molecular Formula | C23H25NO6 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | propan-2-yl 3-[2-[5-(3-nitrophenyl)-3-oxopent-4-enoxy]phenyl]propanoate |
| SMILES | CC(C)OC(=O)CCc1ccccc1OCCC(=O)C=Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H25NO6/c1-17(2)30-23(26)13-11-19-7-3-4-9-22(19)29-15-14-21(25)12-10-18-6-5-8-20(16-18)24(27)28/h3-10,12,16-17H,11,13-15H2,1-2H3 |
| InChIKey | HOFLLIZPUHVGIP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|