C30H36O4 — CID 175545297
propan-2-yl 3-[2-[4-[3-(1-hydroxy-2-phenylethyl)phenyl]butoxy]phenyl]propanoate (PubChem CID 175545297) has the molecular formula C30H36O4 and a molecular weight of 460.61 g/mol. Its IUPAC name is propan-2-yl 3-[2-[4-[3-(1-hydroxy-2-phenylethyl)phenyl]butoxy]phenyl]propanoate.
| Compound Name | propan-2-yl 3-[2-[4-[3-(1-hydroxy-2-phenylethyl)phenyl]butoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 175545297 |
| Molecular Formula | C30H36O4 |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | propan-2-yl 3-[2-[4-[3-(1-hydroxy-2-phenylethyl)phenyl]butoxy]phenyl]propanoate |
| SMILES | CC(C)OC(=O)CCc1ccccc1OCCCCc1cccc(C(O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C30H36O4/c1-23(2)34-30(32)19-18-26-15-6-7-17-29(26)33-20-9-8-13-24-14-10-16-27(21-24)28(31)22-25-11-4-3-5-12-25/h3-7,10-12,14-17,21,23,28,31H,8-9,13,18-20,22H2,1-2H3 |
| InChIKey | SRHLQZDBZNELLA-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|