C20H22BrN3O3S — CID 168612890
benzyl N'-[[5-bromo-2-[2-(1,3-dioxolan-2-yl)ethoxy]phenyl]methylideneamino]carbamimidothioate (PubChem CID 168612890) has the molecular formula C20H22BrN3O3S and a molecular weight of 464.39 g/mol. Its IUPAC name is benzyl N'-[[5-bromo-2-[2-(1,3-dioxolan-2-yl)ethoxy]phenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[5-bromo-2-[2-(1,3-dioxolan-2-yl)ethoxy]phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168612890 |
| Molecular Formula | C20H22BrN3O3S |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | benzyl N'-[[5-bromo-2-[2-(1,3-dioxolan-2-yl)ethoxy]phenyl]methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1cc(Br)ccc1OCCC1OCCO1)SCc1ccccc1 |
| InChI | InChI=1S/C20H22BrN3O3S/c21-17-6-7-18(25-9-8-19-26-10-11-27-19)16(12-17)13-23-24-20(22)28-14-15-4-2-1-3-5-15/h1-7,12-13,19H,8-11,14H2,(H2,22,24) |
| InChIKey | SNFMQUYMQHOZOE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|