C11H11Cl2N5O5 — CID 135900530
2-nitrooxyethyl N-[(E)-N'-[(E)-(2,6-dichlorophenyl)methylideneamino]carbamimidoyl]carbamate (PubChem CID 135900530) has the molecular formula C11H11Cl2N5O5 and a molecular weight of 364.15 g/mol. Its IUPAC name is 2-nitrooxyethyl N-[(E)-N'-[(E)-(2,6-dichlorophenyl)methylideneamino]carbamimidoyl]carbamate.
| Compound Name | 2-nitrooxyethyl N-[(E)-N'-[(E)-(2,6-dichlorophenyl)methylideneamino]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 135900530 |
| Molecular Formula | C11H11Cl2N5O5 |
| Molecular Weight | 364.15 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | 2-nitrooxyethyl N-[(E)-N'-[(E)-(2,6-dichlorophenyl)methylideneamino]carbamimidoyl]carbamate |
| SMILES | N/C(=N\N=C\c1c(Cl)cccc1Cl)NC(=O)OCCO[N+](=O)[O-] |
| InChI | InChI=1S/C11H11Cl2N5O5/c12-8-2-1-3-9(13)7(8)6-15-17-10(14)16-11(19)22-4-5-23-18(20)21/h1-3,6H,4-5H2,(H3,14,16,17,19)/b15-6+ |
| InChIKey | OEFPMFKWHKXXAN-GIDUJCDVSA-N |
| XLogP | 1.58 |
| TPSA | 141.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.15 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|