C10H11ClN4O — CID 137198212
N-[N'-[(Z)-(2-chlorophenyl)methylideneamino]carbamimidoyl]acetamide (PubChem CID 137198212) has the molecular formula C10H11ClN4O and a molecular weight of 238.68 g/mol. Its IUPAC name is N-[N'-[(Z)-(2-chlorophenyl)methylideneamino]carbamimidoyl]acetamide.
| Compound Name | N-[N'-[(Z)-(2-chlorophenyl)methylideneamino]carbamimidoyl]acetamide |
|---|---|
| PubChem CID | 137198212 |
| Molecular Formula | C10H11ClN4O |
| Molecular Weight | 238.68 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | N-[N'-[(Z)-(2-chlorophenyl)methylideneamino]carbamimidoyl]acetamide |
| SMILES | CC(=O)NC(N)=N/N=C\c1ccccc1Cl |
| InChI | InChI=1S/C10H11ClN4O/c1-7(16)14-10(12)15-13-6-8-4-2-3-5-9(8)11/h2-6H,1H3,(H3,12,14,15,16)/b13-6- |
| InChIKey | LKWLEZDTEYSMIU-MLPAPPSSSA-N |
| XLogP | 1.12 |
| TPSA | 79.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.68 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|