C12H17ClN4O2 — CID 140788358
2-[(2-chlorophenyl)methylideneamino]-1-(2-ethoxyethoxy)guanidine (PubChem CID 140788358) has the molecular formula C12H17ClN4O2 and a molecular weight of 284.75 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylideneamino]-1-(2-ethoxyethoxy)guanidine.
| Compound Name | 2-[(2-chlorophenyl)methylideneamino]-1-(2-ethoxyethoxy)guanidine |
|---|---|
| PubChem CID | 140788358 |
| Molecular Formula | C12H17ClN4O2 |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-[(2-chlorophenyl)methylideneamino]-1-(2-ethoxyethoxy)guanidine |
| SMILES | CCOCCON/C(N)=N\N=Cc1ccccc1Cl |
| InChI | InChI=1S/C12H17ClN4O2/c1-2-18-7-8-19-17-12(14)16-15-9-10-5-3-4-6-11(10)13/h3-6,9H,2,7-8H2,1H3,(H3,14,16,17) |
| InChIKey | PGPOIDZGBLXYTB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|