C19H22ClN7O2 — CID 170856367
ethyl 4-[6-[(E)-N'-[(E)-(2-chlorophenyl)methylideneamino]carbamimidoyl]pyrazin-2-yl]piperazine-1-carboxylate (PubChem CID 170856367) has the molecular formula C19H22ClN7O2 and a molecular weight of 415.89 g/mol. Its IUPAC name is ethyl 4-[6-[(E)-N'-[(E)-(2-chlorophenyl)methylideneamino]carbamimidoyl]pyrazin-2-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[6-[(E)-N'-[(E)-(2-chlorophenyl)methylideneamino]carbamimidoyl]pyrazin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 170856367 |
| Molecular Formula | C19H22ClN7O2 |
| Molecular Weight | 415.89 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | ethyl 4-[6-[(E)-N'-[(E)-(2-chlorophenyl)methylideneamino]carbamimidoyl]pyrazin-2-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2cncc(/C(N)=N\N=C\c3ccccc3Cl)n2)CC1 |
| InChI | InChI=1S/C19H22ClN7O2/c1-2-29-19(28)27-9-7-26(8-10-27)17-13-22-12-16(24-17)18(21)25-23-11-14-5-3-4-6-15(14)20/h3-6,11-13H,2,7-10H2,1H3,(H2,21,25)/b23-11+ |
| InChIKey | KCAIYJAOKLGACO-FOKLQQMPSA-N |
| XLogP | 2.15 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.89 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|