C20H25N7O3 — CID 93476422
ethyl 4-[6-[(E)-N'-[(Z)-(2-methoxyphenyl)methylideneamino]carbamimidoyl]pyrazin-2-yl]piperazine-1-carboxylate (PubChem CID 93476422) has the molecular formula C20H25N7O3 and a molecular weight of 411.47 g/mol. Its IUPAC name is ethyl 4-[6-[(E)-N'-[(Z)-(2-methoxyphenyl)methylideneamino]carbamimidoyl]pyrazin-2-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[6-[(E)-N'-[(Z)-(2-methoxyphenyl)methylideneamino]carbamimidoyl]pyrazin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 93476422 |
| Molecular Formula | C20H25N7O3 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | ethyl 4-[6-[(E)-N'-[(Z)-(2-methoxyphenyl)methylideneamino]carbamimidoyl]pyrazin-2-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2cncc(/C(N)=N\N=C/c3ccccc3OC)n2)CC1 |
| InChI | InChI=1S/C20H25N7O3/c1-3-30-20(28)27-10-8-26(9-11-27)18-14-22-13-16(24-18)19(21)25-23-12-15-6-4-5-7-17(15)29-2/h4-7,12-14H,3,8-11H2,1-2H3,(H2,21,25)/b23-12- |
| InChIKey | TZTDFLKBPAJQGS-FMCGGJTJSA-N |
| XLogP | 1.50 |
| TPSA | 118.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|